![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 92 Press Start Title Screen.spc | 2023-09-09 04:40 | 65K | |
| 91 Select Option Title Screen.spc | 2023-09-09 04:40 | 65K | |
| 91 Kill Enemy.spc | 2023-09-09 04:40 | 65K | |
| 91 Glass Break.spc | 2023-09-09 04:40 | 65K | |
| 91 Explosion.spc | 2023-09-09 04:40 | 65K | |
| 13 The Rock 'n Roll Concert.spc | 2023-09-09 04:40 | 65K | |
| 11 KemmyTech Factory.spc | 2023-09-09 04:40 | 65K | |
| 10 The Middle East.spc | 2023-09-09 04:40 | 65K | |
| 09 The Elevator.spc | 2023-09-09 04:40 | 65K | |
| 08 Evergreen Chemical.spc | 2023-09-09 04:40 | 65K | |
| 07 The Amazon Jungle.spc | 2023-09-09 04:40 | 65K | |
| 06 NON Helicopter Pursuit.spc | 2023-09-09 04:40 | 65K | |
| 05 Aerosmith's Dressing Room.spc | 2023-09-09 04:40 | 65K | |
| 04 Secret Concert Room.spc | 2023-09-09 04:40 | 65K | |
| 03 Inside Club X.spc | 2023-09-09 04:40 | 65K | |
| 02 Outside Club X.spc | 2023-09-09 04:40 | 65K | |
| 01 Main Theme.spc | 2023-09-09 04:40 | 65K | |
| 12 Last Battle with Mondor.spc | 2023-07-31 03:56 | 65K | |