![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 39 Battle with Ray Magnus Schabranigdu.spc | 2021-08-01 23:11 | 65K | |
| 18 Downward to the Abandoned Castle.spc | 2021-08-01 23:11 | 65K | |
| 36 Battle with Zeras Metaliom.spc | 2021-08-01 23:11 | 65K | |
| 09 Disquieting Atmosphere.spc | 2021-08-01 23:11 | 65K | |
| 35 Sairag the Doomed City.spc | 2021-08-01 23:11 | 65K | |
| 23 Devastated Atlus City.spc | 2021-08-01 23:11 | 65K | |
| 40 The Second Ending.spc | 2021-08-01 23:11 | 65K | |
| 02 The First Village.spc | 2021-08-01 23:11 | 65K | |
| 37 The First Ending.spc | 2021-08-01 23:11 | 65K | |
| 27 Labinero Village.spc | 2021-08-01 23:11 | 65K | |
| 38 Peterus Village.spc | 2021-08-01 23:11 | 65K | |
| 26 Malene Village.spc | 2021-08-01 23:11 | 65K | |
| 11 Hydra Mountain.spc | 2021-08-01 23:11 | 65K | |
| 34 Figaro Castle.spc | 2021-08-01 23:11 | 65K | |
| 25 Mayela Village.spc | 2021-08-01 23:11 | 65K | |
| 22 Crimson Town.spc | 2021-08-01 23:11 | 65K | |
| 20 Sorcery Church.spc | 2021-08-01 23:11 | 65K | |
| 15 Magical Doctor.spc | 2021-08-01 23:11 | 65K | |
| 31 Peace of Mind.spc | 2021-08-01 23:11 | 65K | |
| 30 Seirun Castle.spc | 2021-08-01 23:11 | 65K | |
| 21 Vaile Castle.spc | 2021-08-01 23:11 | 65K | |
| 13 Johannes City.spc | 2021-08-01 23:11 | 65K | |
| 32 Okus Village.spc | 2021-08-01 23:11 | 65K | |
| 28 Sigmun City.spc | 2021-08-01 23:11 | 65K | |
| 17 Figaro City.spc | 2021-08-01 23:11 | 65K | |
| 12 Thieves' Den.spc | 2021-08-01 23:11 | 65K | |
| 33 Tairer City.spc | 2021-08-01 23:11 | 65K | |
| 29 Seirun City.spc | 2021-08-01 23:11 | 65K | |
| 24 Tales City.spc | 2021-08-01 23:11 | 65K | |
| 19 Atlus City.spc | 2021-08-01 23:11 | 65K | |
| 08 Boss Battle.spc | 2021-08-01 23:11 | 65K | |
| 14 Drug Store.spc | 2021-08-01 23:11 | 65K | |
| 03 Villagers.spc | 2021-08-01 23:11 | 65K | |
| 05 Dialogues.spc | 2021-08-01 23:11 | 65K | |
| 06 Status.spc | 2021-08-01 23:11 | 65K | |
| 16 Church.spc | 2021-08-01 23:11 | 65K | |
| 07 Battle.spc | 2021-08-01 23:11 | 65K | |
| 10 Map.spc | 2021-08-01 23:11 | 65K | |
| 04 Cave.spc | 2021-08-01 23:11 | 65K | |
| 99 Farewell to an Ally.spc | 2021-08-01 23:11 | 65K | |
| 99 Ally Joins.spc | 2021-08-01 23:11 | 65K | |
| 01 Opening.spc | 2021-08-01 23:11 | 65K | |
| 99 New Maps.spc | 2021-08-01 23:11 | 65K | |
| 99 Victory.spc | 2021-08-01 23:11 | 65K | |
| 99 Sleep.spc | 2021-08-01 23:11 | 65K | |
| 99 Item.spc | 2021-08-01 23:11 | 65K | |