![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | 076 Hi Hi Hi.spc | 2016-02-22 15:48 | 65K | |
| 037 Franky.spc | 2016-02-22 15:48 | 65K | |
| 901 Hidden Track.spc | 2016-02-22 15:48 | 65K | |
| 117 Welcome Home.spc | 2016-02-22 15:48 | 65K | |
| 082 Super Dry Dance.spc | 2016-02-22 15:48 | 65K | |
| 063 Snowman.spc | 2016-02-22 15:48 | 65K | |
| 087 Save the Miners!.spc | 2016-02-22 15:48 | 65K | |
| 064 Winters White.spc | 2016-02-22 15:48 | 65K | |
| 033 You Win!.spc | 2016-02-22 15:48 | 65K | |
| 023 Buy Somethin' Will Ya!.spc | 2016-02-22 15:48 | 65K | |
| 138 Because I Love You.spc | 2016-02-22 15:48 | 65K | |
| 115 Eight Melodies.spc | 2016-02-22 15:48 | 65K | |
| 096 Mu Training.spc | 2016-02-22 15:48 | 65K | |
| 089 Moonside Swing.spc | 2016-02-22 15:48 | 65K | |
| 088 Boris' Cocktail.spc | 2016-02-22 15:48 | 65K | |
| 067 Tessie!.spc | 2016-02-22 15:48 | 65K | |
| 048 Boy Meets Girl.spc | 2016-02-22 15:48 | 65K | |
| 042 Sanctuary Guardian.spc | 2016-02-22 15:48 | 65K | |
| 026 Bed and Breakfast.spc | 2016-02-22 15:48 | 65K | |
| 021 Home Sweet Home.spc | 2016-02-22 15:48 | 65K | |
| 126 The Place.spc | 2016-02-22 15:48 | 65K | |
| 104 Inside the Dungeon.spc | 2016-02-22 15:48 | 65K | |
| 100 Bazaar.spc | 2016-02-22 15:48 | 65K | |
| 084 Topolla Theatre, Home to the One & Only Venus.spc | 2016-02-22 15:48 | 65K | |
| 121 The Power.spc | 2016-02-22 15:48 | 65K | |
| 120 Sea of Eden.spc | 2016-02-22 15:48 | 65K | |
| 105 Megaton Walk.spc | 2016-02-22 15:48 | 65K | |
| 041 Oncoming Boss.spc | 2016-02-22 15:48 | 65K | |
| 140 Smiles and Tears.spc | 2016-02-22 15:48 | 65K | |
| 139 Good Friends, Bad Friends.spc | 2016-02-22 15:48 | 65K | |
| 038 Battle Against an Unsettling Opponent.spc | 2016-02-22 15:48 | 65K | |
| 123 Spacetoneer.spc | 2016-02-22 15:48 | 65K | |
| 114q Sound Stone ~ Fire Spring (Complete).spc | 2016-02-22 15:48 | 65K | |
| 114p Sound Stone ~ Lumine Hall (Complete).spc | 2016-02-22 15:48 | 65K | |
| 114n Sound Stone ~ Magnet Hill (Complete).spc | 2016-02-22 15:48 | 65K | |
| 114m Sound Stone ~ Rainy Circle (Complete).spc | 2016-02-22 15:48 | 65K | |
| 114k Sound Stone ~ Lilliput Steps (Complete).spc | 2016-02-22 15:48 | 65K | |
| 114r Sound Stone ~ No Sounds (Complete).spc | 2016-02-22 15:48 | 65K | |
| 114o Sound Stone ~ Pink Cloud (Complete).spc | 2016-02-22 15:48 | 65K | |
| 114l Sound Stone ~ Milky Well (Complete).spc | 2016-02-22 15:48 | 65K | |
| 114j Sound Stone ~ Giant Step (Complete).spc | 2016-02-22 15:48 | 65K | |
| 028 Oncoming Foe.spc | 2016-02-22 15:48 | 65K | |
| 001b The Evil Giygas Attacks! (part 2).spc | 2016-02-22 15:48 | 65K | |
| 001a The Evil Giygas Attacks! (part 1).spc | 2016-02-22 15:48 | 65K | |
| 919 Phone.spc | 2016-02-22 15:48 | 65K | |
| 918 Drilling.spc | 2016-02-22 15:48 | 65K | |
| 917 Mechanical Tinkering.spc | 2016-02-22 15:48 | 65K | |
| 136 Giygas' Static.spc | 2016-02-22 15:48 | 65K | |
| 135 Giygas Disintegrates.spc | 2016-02-22 15:48 | 65K | |
| 134 Giygas is Fatally Wounded!.spc | 2016-02-22 15:48 | 65K | |
| 133 Giygas is Wounded!.spc | 2016-02-22 15:48 | 65K | |
| 132 Prayer for Safety.spc | 2016-02-22 15:48 | 65K | |
| 131 Giygas' Intimidation.spc | 2016-02-22 15:48 | 65K | |
| 130 Giygas Stirs.spc | 2016-02-22 15:48 | 65K | |
| 129 Pokey Means Business!.spc | 2016-02-22 15:48 | 65K | |
| 128 Giygas' Intro.spc | 2016-02-22 15:48 | 65K | |
| 127 Giygas' Lair.spc | 2016-02-22 15:48 | 65K | |
| 125 The Cliff That Time Forgot.spc | 2016-02-22 15:48 | 65K | |
| 119 Deeper into Ness' Subconscious.spc | 2016-02-22 15:48 | 65K | |
| 118 The Jolly Flying Man.spc | 2016-02-22 15:48 | 65K | |
| 113 Lava Springs.spc | 2016-02-22 15:48 | 65K | |
| 112 The Lost Underworld.spc | 2016-02-22 15:48 | 65K | |
| 110 Stonehenge Base Shuts Down.spc | 2016-02-22 15:48 | 65K | |
| 109 Battle Against a Machine.spc | 2016-02-22 15:48 | 65K | |
| 108 The Tendas' Cave.spc | 2016-02-22 15:48 | 65K | |
| 107 The Deep Darkness.spc | 2016-02-22 15:48 | 65K | |
| 106 The Submarine.spc | 2016-02-22 15:48 | 65K | |
| 103 Pyramid.spc | 2016-02-22 15:48 | 65K | |
| 102 The Unforgiving Desert.spc | 2016-02-22 15:48 | 65K | |
| 101 Morning in the Desert.spc | 2016-02-22 15:48 | 65K | |
| 099 Kraken of the Sea.spc | 2016-02-22 15:48 | 65K | |
| 098b The Voyage Continues.spc | 2016-02-22 15:48 | 65K | |
| 098a Sailing to Scaraba.spc | 2016-02-22 15:48 | 65K | |
| 097 Pink Cloud Shrine.spc | 2016-02-22 15:48 | 65K | |
| 095 The Floating Kingdom of Dalaam.spc | 2016-02-22 15:48 | 65K | |
| 094 In Dalaam, There is a Warrior.spc | 2016-02-22 15:48 | 65K | |
| 093 Summers, Eternal Tourist Trap.spc | 2016-02-22 15:48 | 65K | |
| 092 Runaway Five to the Rescue!.spc | 2016-02-22 15:48 | 65K | |
| 091 The Monkeys' Maze.spc | 2016-02-22 15:48 | 65K | |
| 090 Bad Morning to You.spc | 2016-02-22 15:48 | 65K | |
| 083 The Metropolis of Fourside.spc | 2016-02-22 15:48 | 65K | |
| 081 Get on the Bus.spc | 2016-02-22 15:48 | 65K | |
| 080 Threed, Free at Last.spc | 2016-02-22 15:48 | 65K | |
| 079 You've Come Far, Ness.spc | 2016-02-22 15:48 | 65K | |
| 078 Battle Against Belch.spc | 2016-02-22 15:48 | 65K | |
| 077 Belch's Factory.spc | 2016-02-22 15:48 | 65K | |
| 075 Saturn Valley Caverns.spc | 2016-02-22 15:48 | 65K | |
| 074 Zombie Paper.spc | 2016-02-22 15:48 | 65K | |
| 073 Escargo Express at Your Service!.spc | 2016-02-22 15:48 | 65K | |
| 070 The Sky Runner.spc | 2016-02-22 15:48 | 65K | |
| 069 Dr. Andonuts' Lab.spc | 2016-02-22 15:48 | 65K | |
| 068 Caverns of Winters.spc | 2016-02-22 15:48 | 65K | |
| 066 Tessie Has Been Sighted!.spc | 2016-02-22 15:48 | 65K | |
| 065 Winters Wake Up Call.spc | 2016-02-22 15:48 | 65K | |
| 060 Heartless Hotel.spc | 2016-02-22 15:48 | 65K | |
| 059 Threed, Zombie Central.spc | 2016-02-22 15:48 | 65K | |
| 058 Runaway Five on the Move!.spc | 2016-02-22 15:48 | 65K | |
| 057 Runaway Five Left the Building!.spc | 2016-02-22 15:48 | 65K | |
| 055 Dead-End Chaos Theatre.spc | 2016-02-22 15:48 | 65K | |
| 053 Happy-Happy is Blue.spc | 2016-02-22 15:48 | 65K | |
| 052b Flowing Water.spc | 2016-02-22 15:48 | 65K | |
| 052a Peaceful Rest Valley.spc | 2016-02-22 15:48 | 65K | |
| 051 Paula's Theme.spc | 2016-02-22 15:48 | 65K | |
| 050 Ness' Bike.spc | 2016-02-22 15:48 | 65K | |
| 049 Apple Kid's Theme.spc | 2016-02-22 15:48 | 65K | |
| 047 A Flash of Memory.spc | 2016-02-22 15:48 | 65K | |
| 046h Your Sanctuary ~ Fire Spring.spc | 2016-02-22 15:48 | 65K | |
| 046g Your Sanctuary ~ Lumine Hall.spc | 2016-02-22 15:48 | 65K | |
| 046f Your Sanctuary ~ Pink Cloud.spc | 2016-02-22 15:48 | 65K | |
| 046e Your Sanctuary ~ Magnet Hill.spc | 2016-02-22 15:48 | 65K | |
| 046d Your Sanctuary ~ Rainy Circle.spc | 2016-02-22 15:48 | 65K | |
| 046c Your Sanctuary ~ Milky Well.spc | 2016-02-22 15:48 | 65K | |
| 046b Your Sanctuary ~ Lilliput Steps.spc | 2016-02-22 15:48 | 65K | |
| 046a Your Sanctuary ~ Giant Step.spc | 2016-02-22 15:48 | 65K | |
| 045 Welcome to Your Sanctuary.spc | 2016-02-22 15:48 | 65K | |
| 044 You Defeated the Boss!.spc | 2016-02-22 15:48 | 65K | |
| 043 A Bad Dream.spc | 2016-02-22 15:48 | 65K | |
| 040 Sanctuary Guardian's Challenge.spc | 2016-02-22 15:48 | 65K | |
| 039 Dangerous Caves.spc | 2016-02-22 15:48 | 65K | |
| 036 Onett's Arcade.spc | 2016-02-22 15:48 | 65K | |
| 035 You Gained a Level!.spc | 2016-02-22 15:48 | 65K | |
| 034 That Was Easy!.spc | 2016-02-22 15:48 | 65K | |
| 032 Battle Against a Mobile Opponent.spc | 2016-02-22 15:48 | 65K | |
| 031 Battle Against a Weird Opponent.spc | 2016-02-22 15:48 | 65K | |
| 030 Battle Against a Weak Opponent.spc | 2016-02-22 15:48 | 65K | |
| 027 Hospital.spc | 2016-02-22 15:48 | 65K | |
| 024 Enjoy Your Stay.spc | 2016-02-22 15:48 | 65K | |
| 022 Friendly Neighbors.spc | 2016-02-22 15:48 | 65K | |
| 020 What a Great Picture!.spc | 2016-02-22 15:48 | 65K | |
| 019b Onett Theme.spc | 2016-02-22 15:48 | 65K | |
| 019a Sunrise & Onett Theme.spc | 2016-02-22 15:48 | 65K | |
| 018b Pokey's House (Buzz Buzz).spc | 2016-02-22 15:48 | 65K | |
| 018a Pokey's House.spc | 2016-02-22 15:48 | 65K | |
| 017 Otherworldly Foe.spc | 2016-02-22 15:48 | 65K | |
| 016c Onett Buzz Buzz 3.spc | 2016-02-22 15:48 | 65K | |
| 016b Onett Buzz Buzz 2.spc | 2016-02-22 15:48 | 65K | |
| 016a Onett Buzz Buzz 1.spc | 2016-02-22 15:48 | 65K | |
| 015c Onett Night 3.spc | 2016-02-22 15:48 | 65K | |
| 015b Onett Night 2.spc | 2016-02-22 15:48 | 65K | |
| 015a Onett Night 1.spc | 2016-02-22 15:48 | 65K | |
| 014 Buzz Buzz's Prophecy.spc | 2016-02-22 15:48 | 65K | |
| 012 Pokey.spc | 2016-02-22 15:48 | 65K | |
| 010b What an Annoying Knock!.spc | 2016-02-22 15:48 | 65K | |
| 010a Someone's Knocking at the Door.spc | 2016-02-22 15:48 | 65K | |
| 009b Alien Invasion 2.spc | 2016-02-22 15:48 | 65K | |
| 009a Alien Invasion 1.spc | 2016-02-22 15:48 | 65K | |
| 008b Rude Awakening.spc | 2016-02-22 15:48 | 65K | |
| 007 One Fateful Night....spc | 2016-02-22 15:48 | 65K | |
| 005b Your Name, Please (Noiseless).spc | 2016-02-22 15:48 | 65K | |
| 005a Your Name, Please.spc | 2016-02-22 15:48 | 65K | |
| 004 Choose a File.spc | 2016-02-22 15:48 | 65K | |
| 921 Burp.spc | 2016-02-22 15:48 | 65K | |
| 920 OK 'Ssuka_.spc | 2016-02-22 15:48 | 65K | |
| 916 Buzz Buzz's Demise.spc | 2016-02-22 15:48 | 65K | |
| 915b Teleportation End.spc | 2016-02-22 15:48 | 65K | |
| 915a Teleportation.spc | 2016-02-22 15:48 | 65K | |
| 914f The Sphinx's Puzzle Solved!.spc | 2016-02-22 15:48 | 65K | |
| 914e The Sphinx's Puzzle 5.spc | 2016-02-22 15:48 | 65K | |
| 914d The Sphinx's Puzzle 4.spc | 2016-02-22 15:48 | 65K | |
| 914c The Sphinx's Puzzle 3.spc | 2016-02-22 15:48 | 65K | |
| 914b The Sphinx's Puzzle 2.spc | 2016-02-22 15:48 | 65K | |
| 914a The Sphinx's Puzzle 1.spc | 2016-02-22 15:48 | 65K | |
| 913 Master of the Stars.spc | 2016-02-22 15:48 | 65K | |
| 912 Magic Butterfly.spc | 2016-02-22 15:48 | 65K | |
| 911 Evil Mani Mani Statue.spc | 2016-02-22 15:48 | 65K | |
| 910 Spooky....spc | 2016-02-22 15:48 | 65K | |
| 909 Secret Passage.spc | 2016-02-22 15:48 | 65K | |
| 908 Spell Learned.spc | 2016-02-22 15:48 | 65K | |
| 907 Key Item Fanfare.spc | 2016-02-22 15:48 | 65K | |
| 906 Onett's Trumpet Player.spc | 2016-02-22 15:48 | 65K | |
| 905 Mysterious Crash.spc | 2016-02-22 15:48 | 65K | |
| 904 Unknown Jingle 2.spc | 2016-02-22 15:48 | 65K | |
| 903 Unknown Jingle 1.spc | 2016-02-22 15:48 | 65K | |
| 902 Unused Pokey Jingle.spc | 2016-02-22 15:48 | 65K | |
| 137b The Heroes Return (part 2).spc | 2016-02-22 15:48 | 65K | |
| 137a The Heroes Return (part 1).spc | 2016-02-22 15:48 | 65K | |
| 124b Phase Distorter Success.spc | 2016-02-22 15:48 | 65K | |
| 124a Phase Distorter Failed.spc | 2016-02-22 15:48 | 65K | |
| 122 Ness Awakens from the Nightmare.spc | 2016-02-22 15:48 | 65K | |
| 116 The Nightmare Begins....spc | 2016-02-22 15:48 | 65K | |
| 114i Sound Stone ~ No Sounds.spc | 2016-02-22 15:48 | 65K | |
| 114h Sound Stone ~ Fire Spring.spc | 2016-02-22 15:48 | 65K | |
| 114g Sound Stone ~ Lumine Hall.spc | 2016-02-22 15:48 | 65K | |
| 114f Sound Stone ~ Pink Cloud.spc | 2016-02-22 15:48 | 65K | |
| 114e Sound Stone ~ Magnet Hill.spc | 2016-02-22 15:48 | 65K | |
| 114d Sound Stone ~ Rainy Circle.spc | 2016-02-22 15:48 | 65K | |
| 114c Sound Stone ~ Milky Well.spc | 2016-02-22 15:48 | 65K | |
| 114b Sound Stone ~ Lilliput Steps.spc | 2016-02-22 15:48 | 65K | |
| 114a Sound Stone ~ Giant Step.spc | 2016-02-22 15:48 | 65K | |
| 111 Falling Underground!.spc | 2016-02-22 15:48 | 65K | |
| 086 Venus Live!.spc | 2016-02-22 15:48 | 65K | |
| 085 Runaway Five's Final Performance.spc | 2016-02-22 15:48 | 65K | |
| 072 Rough Landing.spc | 2016-02-22 15:48 | 65K | |
| 071 Going Down!.spc | 2016-02-22 15:48 | 65K | |
| 062 In Winters, There is a Genius.spc | 2016-02-22 15:48 | 65K | |
| 061 Whoops!.spc | 2016-02-22 15:48 | 65K | |
| 056 Runaway Five ~ The Daily Show.spc | 2016-02-22 15:48 | 65K | |
| 054 You've Got a New Friend!.spc | 2016-02-22 15:48 | 65K | |
| 029 Ambush!.spc | 2016-02-22 15:48 | 65K | |
| 025 A Good Night's Rest.spc | 2016-02-22 15:48 | 65K | |
| 013 A Good Buddy.spc | 2016-02-22 15:48 | 65K | |
| 011 Whoa!.spc | 2016-02-22 15:48 | 65K | |
| 008a Unidentified Falling Object.spc | 2016-02-22 15:48 | 65K | |
| 006 Now, Let's Go!.spc | 2016-02-22 15:48 | 65K | |
| 003 Opening Credits.spc | 2016-02-22 15:48 | 65K | |
| 002 Title Screen.spc | 2016-02-22 15:48 | 65K | |
|
|---|