![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Thumbs.db | 2011-12-01 03:53 | 6.5K | |
| Folder.jpg | 2011-04-06 03:25 | 23K | |
| AlbumArtSmall.jpg | 2011-04-06 03:25 | 6.6K | |
| 02 Chemical Marriage.mp3 | 2009-04-23 16:04 | 4.8M | |
| 01 Everyone I Went to High School With Is Dead.mp3 | 2009-04-23 16:04 | 4.0M | |
| Disco Volante.m3u | 2007-09-17 07:11 | 1.0K | |
| 10 Backstrokin'.mp3 | 2006-06-20 11:57 | 3.7M | |
| 04 Desert Search for Techno Allah.mp3 | 2006-06-20 11:55 | 8.5M | |
| 07 Phlegmatics.mp3 | 2006-06-20 11:54 | 4.6M | |
| 08 Ma Meeshka Mow Skwoz.mp3 | 2006-06-20 11:51 | 7.2M | |
| 11 Platypus.mp3 | 2006-06-20 11:48 | 8.2M | |
| 12 Merry Go Bye Bye_Nothing.mp3 | 2006-06-20 11:46 | 19M | |
| 03 Carry Stress in the Jaw.mp3 | 2006-06-20 11:44 | 12M | |
| 09 The Bends_ [Man Overboard_The Drowning Flute_Aqua Swing_Follow the Bubbles].mp3 | 2006-06-20 11:39 | 14M | |
| 05 Violenza Domestica.mp3 | 2006-06-20 11:34 | 7.6M | |
| 06 After School Special.mp3 | 2006-06-20 11:08 | 4.1M | |